C15H17F2N3O2S — CID 147508593
6,7-difluoro-4-[3-(methylsulfonylmethyl)piperidin-1-yl]quinazoline (PubChem CID 147508593) has the molecular formula C15H17F2N3O2S and a molecular weight of 341.38 g/mol. Its IUPAC name is 6,7-difluoro-4-[3-(methylsulfonylmethyl)piperidin-1-yl]quinazoline.
| Compound Name | 6,7-difluoro-4-[3-(methylsulfonylmethyl)piperidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 147508593 |
| Molecular Formula | C15H17F2N3O2S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 6,7-difluoro-4-[3-(methylsulfonylmethyl)piperidin-1-yl]quinazoline |
| SMILES | CS(=O)(=O)CC1CCCN(c2ncnc3cc(F)c(F)cc23)C1 |
| InChI | InChI=1S/C15H17F2N3O2S/c1-23(21,22)8-10-3-2-4-20(7-10)15-11-5-12(16)13(17)6-14(11)18-9-19-15/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | FIVIUCYUGBFKKF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |