C21H31N3O7S — CID 147516456
2-(2-methoxyethoxy)ethyl N-[1-(6,7-dioxo-5,8,9,10-tetrahydro-4H-[1,3]thiazolo[5,4-c]azonin-8-yl)-4-methyl-2-oxopentan-3-yl]carbamate (PubChem CID 147516456) has the molecular formula C21H31N3O7S and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl N-[1-(6,7-dioxo-5,8,9,10-tetrahydro-4H-[1,3]thiazolo[5,4-c]azonin-8-yl)-4-methyl-2-oxopentan-3-yl]carbamate.
| Compound Name | 2-(2-methoxyethoxy)ethyl N-[1-(6,7-dioxo-5,8,9,10-tetrahydro-4H-[1,3]thiazolo[5,4-c]azonin-8-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 147516456 |
| Molecular Formula | C21H31N3O7S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl N-[1-(6,7-dioxo-5,8,9,10-tetrahydro-4H-[1,3]thiazolo[5,4-c]azonin-8-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
| SMILES | COCCOCCOC(=O)NC(C(=O)CC1CCc2ncsc2CNC(=O)C1=O)C(C)C |
| InChI | InChI=1S/C21H31N3O7S/c1-13(2)18(24-21(28)31-9-8-30-7-6-29-3)16(25)10-14-4-5-15-17(32-12-23-15)11-22-20(27)19(14)26/h12-14,18H,4-11H2,1-3H3,(H,22,27)(H,24,28) |
| InChIKey | FKIBEDFEQLLEQE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|