About 3-amino-N',2-dimethylbut-2-enimidamide
3-amino-N',2-dimethylbut-2-enimidamide (PubChem CID 147517361) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 3-amino-N',2-dimethylbut-2-enimidamide.
Molecular Properties
| Compound Name | 3-amino-N',2-dimethylbut-2-enimidamide |
| PubChem CID | 147517361 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 3-amino-N',2-dimethylbut-2-enimidamide |
| SMILES | C/N=C(\N)C(C)=C(C)N |
| InChI | InChI=1S/C6H13N3/c1-4(5(2)7)6(8)9-3/h7H2,1-3H3,(H2,8,9) |
| InChIKey | GNHBOGNNDXMCCI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N',2-dimethylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N',2-dimethylbut-2-enimidamide?
The IUPAC name of 3-amino-N',2-dimethylbut-2-enimidamide (CID 147517361) is 3-amino-N',2-dimethylbut-2-enimidamide.
What is the SMILES notation for 3-amino-N',2-dimethylbut-2-enimidamide?
The canonical SMILES for 3-amino-N',2-dimethylbut-2-enimidamide is C/N=C(\N)C(C)=C(C)N.
What is the InChIKey of 3-amino-N',2-dimethylbut-2-enimidamide?
The InChIKey is GNHBOGNNDXMCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-4(5(2)7)6(8)9-3/h7H2,1-3H3,(H2,8,9).
What are the key properties of 3-amino-N',2-dimethylbut-2-enimidamide?
3-amino-N',2-dimethylbut-2-enimidamide has a molecular weight of 127.19 g/mol, XLogP of 0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N',2-dimethylbut-2-enimidamide is sourced from PubChem (CID 147517361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).