C35H48O12Si — CID 14752043
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[tert-butyl(diphenyl)silyl]oxy-2-methoxybutan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 14752043) has the molecular formula C35H48O12Si and a molecular weight of 688.84 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[tert-butyl(diphenyl)silyl]oxy-2-methoxybutan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[tert-butyl(diphenyl)silyl]oxy-2-methoxybutan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14752043 |
| Molecular Formula | C35H48O12Si |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[tert-butyl(diphenyl)silyl]oxy-2-methoxybutan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | COC(C)(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C35H48O12Si/c1-23(36)41-22-29-30(43-24(2)37)31(44-25(3)38)32(45-26(4)39)33(46-29)47-35(8,40-9)20-21-42-48(34(5,6)7,27-16-12-10-13-17-27)28-18-14-11-15-19-28/h10-19,29-33H,20-22H2,1-9H3/t29-,30-,31+,32-,33+,35?/m1/s1 |
| InChIKey | NYEPQUYVTGPIQE-NOQCOBGDSA-N |
| XLogP | 3.42 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|