C25H22F2O4 — CID 147521434
6-[(2,4-difluorophenyl)methyl]-13-(2,3-dihydroxypropoxy)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (PubChem CID 147521434) has the molecular formula C25H22F2O4 and a molecular weight of 424.44 g/mol. Its IUPAC name is 6-[(2,4-difluorophenyl)methyl]-13-(2,3-dihydroxypropoxy)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one.
| Compound Name | 6-[(2,4-difluorophenyl)methyl]-13-(2,3-dihydroxypropoxy)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 147521434 |
| Molecular Formula | C25H22F2O4 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 6-[(2,4-difluorophenyl)methyl]-13-(2,3-dihydroxypropoxy)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| SMILES | O=C1c2ccc(Cc3ccc(F)cc3F)cc2CCc2cc(OCC(O)CO)ccc21 |
| InChI | InChI=1S/C25H22F2O4/c26-19-5-4-18(24(27)12-19)10-15-1-7-22-16(9-15)2-3-17-11-21(31-14-20(29)13-28)6-8-23(17)25(22)30/h1,4-9,11-12,20,28-29H,2-3,10,13-14H2 |
| InChIKey | FLFZBANOZOELID-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |