C30H33F3N8O — CID 147524822
6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enyl-1-[6-(trifluoromethyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 147524822) has the molecular formula C30H33F3N8O and a molecular weight of 578.64 g/mol. Its IUPAC name is 6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enyl-1-[6-(trifluoromethyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enyl-1-[6-(trifluoromethyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 147524822 |
| Molecular Formula | C30H33F3N8O |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enyl-1-[6-(trifluoromethyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCC5(CCN(C)CC5)CC4)cc3)nc2n1-c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C30H33F3N8O/c1-3-15-40-27(42)23-20-34-28(37-26(23)41(40)25-6-4-5-24(36-25)30(31,32)33)35-21-7-9-22(10-8-21)39-18-13-29(14-19-39)11-16-38(2)17-12-29/h3-10,20H,1,11-19H2,2H3,(H,34,35,37) |
| InChIKey | FLWLGZQZNAISEH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|