About 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide
3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide (PubChem CID 147527241) has the molecular formula C24H30N4O2
and a molecular weight of 406.53 g/mol. Its IUPAC name is 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide |
| PubChem CID | 147527241 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide |
| SMILES | CCCCN(C)Cc1[nH]ncc1-c1ccc(Oc2cccc(C(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C24H30N4O2/c1-5-6-14-28(4)17-23-22(16-25-26-23)18-10-12-20(13-11-18)30-21-9-7-8-19(15-21)24(29)27(2)3/h7-13,15-16H,5-6,14,17H2,1-4H3,(H,25,26) |
| InChIKey | FMIIZIIZCGTKLS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide?
The IUPAC name of 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide (CID 147527241) is 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide.
What is the SMILES notation for 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide?
The canonical SMILES for 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide is CCCCN(C)Cc1[nH]ncc1-c1ccc(Oc2cccc(C(=O)N(C)C)c2)cc1.
What is the InChIKey of 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide?
The InChIKey is FMIIZIIZCGTKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O2/c1-5-6-14-28(4)17-23-22(16-25-26-23)18-10-12-20(13-11-18)30-21-9-7-8-19(15-21)24(29)27(2)3/h7-13,15-16H,5-6,14,17H2,1-4H3,(H,25,26).
What are the key properties of 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide?
3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide has a molecular weight of 406.53 g/mol, XLogP of 4.80, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[5-[[butyl(methyl)amino]methyl]-1H-pyrazol-4-yl]phenoxy]-N,N-dimethylbenzamide is sourced from PubChem (CID 147527241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).