C20H17FN4O — CID 147527260
(S)-(4-fluorophenyl)-[4-[(3-methyl-2H-pyrrol-5-yl)amino]quinazolin-2-yl]methanol (PubChem CID 147527260) has the molecular formula C20H17FN4O and a molecular weight of 348.38 g/mol. Its IUPAC name is (S)-(4-fluorophenyl)-[4-[(3-methyl-2H-pyrrol-5-yl)amino]quinazolin-2-yl]methanol.
| Compound Name | (S)-(4-fluorophenyl)-[4-[(3-methyl-2H-pyrrol-5-yl)amino]quinazolin-2-yl]methanol |
|---|---|
| PubChem CID | 147527260 |
| Molecular Formula | C20H17FN4O |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (S)-(4-fluorophenyl)-[4-[(3-methyl-2H-pyrrol-5-yl)amino]quinazolin-2-yl]methanol |
| SMILES | CC1=CC(Nc2nc([C@@H](O)c3ccc(F)cc3)nc3ccccc23)=NC1 |
| InChI | InChI=1S/C20H17FN4O/c1-12-10-17(22-11-12)24-19-15-4-2-3-5-16(15)23-20(25-19)18(26)13-6-8-14(21)9-7-13/h2-10,18,26H,11H2,1H3,(H,22,23,24,25)/t18-/m0/s1 |
| InChIKey | FMILXJQXPFGODR-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |