About cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol
cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol (PubChem CID 147527605) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol |
| PubChem CID | 147527605 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol |
| SMILES | [C-]#[N+]c1ccc([C@H]2CCCC[C@H]2O)cc1C |
| InChI | InChI=1S/C14H17NO/c1-10-9-11(7-8-13(10)15-2)12-5-3-4-6-14(12)16/h7-9,12,14,16H,3-6H2,1H3/t12-,14-/m1/s1 |
| InChIKey | FMJXEDISUCEIMV-TZMCWYRMSA-N |
| XLogP | 3.56 |
| TPSA | 24.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol?
The IUPAC name of cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol (CID 147527605) is cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol.
What is the SMILES notation for cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol?
The canonical SMILES for cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol is [C-]#[N+]c1ccc([C@H]2CCCC[C@H]2O)cc1C.
What is the InChIKey of cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol?
The InChIKey is FMJXEDISUCEIMV-TZMCWYRMSA-N. The full InChI is InChI=1S/C14H17NO/c1-10-9-11(7-8-13(10)15-2)12-5-3-4-6-14(12)16/h7-9,12,14,16H,3-6H2,1H3/t12-,14-/m1/s1.
What are the key properties of cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol?
cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol has a molecular weight of 215.30 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-2-(4-isocyano-3-methylphenyl)cyclohexan-1-ol is sourced from PubChem (CID 147527605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).