C41H79N3 — CID 147530744
2-[2-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]hydrazinyl]-N,N-dimethylethanamine (PubChem CID 147530744) has the molecular formula C41H79N3 and a molecular weight of 614.10 g/mol. Its IUPAC name is 2-[2-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]hydrazinyl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]hydrazinyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 147530744 |
| Molecular Formula | C41H79N3 |
| Molecular Weight | 614.10 g/mol |
| Exact Mass | 613.63 |
| IUPAC Name | 2-[2-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]hydrazinyl]-N,N-dimethylethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)NNCCN(C)C |
| InChI | InChI=1S/C41H79N3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(43-42-39-40-44(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,41-43H,5-12,17-18,23-40H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | FMZHRHAFGJDYSI-KWXKLSQISA-N |
| XLogP | 12.42 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.10 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|