C21H28O4 — CID 14753642
[(9Z)-15-acetyloxyheptadeca-9,16-dien-11,13-diyn-8-yl] acetate (PubChem CID 14753642) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is [(9Z)-15-acetyloxyheptadeca-9,16-dien-11,13-diyn-8-yl] acetate.
| Compound Name | [(9Z)-15-acetyloxyheptadeca-9,16-dien-11,13-diyn-8-yl] acetate |
|---|---|
| PubChem CID | 14753642 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(9Z)-15-acetyloxyheptadeca-9,16-dien-11,13-diyn-8-yl] acetate |
| SMILES | C=CC(C#CC#C/C=C\C(CCCCCCC)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C21H28O4/c1-5-7-8-9-13-16-21(25-19(4)23)17-14-11-10-12-15-20(6-2)24-18(3)22/h6,14,17,20-21H,2,5,7-9,13,16H2,1,3-4H3/b17-14- |
| InChIKey | OGCCCDUWZCPUNH-VKAVYKQESA-N |
| XLogP | 3.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|