C16H23ClN5O7P — CID 147537372
[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)triazolo[4,5-c]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 147537372) has the molecular formula C16H23ClN5O7P and a molecular weight of 463.82 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)triazolo[4,5-c]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)triazolo[4,5-c]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 147537372 |
| Molecular Formula | C16H23ClN5O7P |
| Molecular Weight | 463.82 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)triazolo[4,5-c]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)nc(Cl)cc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23ClN5O7P/c17-11-5-9-12(15(19-11)18-8-3-1-2-4-8)20-21-22(9)16-14(24)13(23)10(29-16)6-28-7-30(25,26)27/h5,8,10,13-14,16,23-24H,1-4,6-7H2,(H,18,19)(H2,25,26,27)/t10-,13-,14-,16-/m1/s1 |
| InChIKey | FOFOURGFNIMPOA-DSPGLSBSSA-N |
| XLogP | 0.61 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.82 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|