About 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one
6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one (PubChem CID 1475385) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one |
| PubChem CID | 1475385 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one |
| SMILES | C=CCN1N=C(/C=C/c2ccc(OC)cc2)CCC1=O |
| InChI | InChI=1S/C16H18N2O2/c1-3-12-18-16(19)11-8-14(17-18)7-4-13-5-9-15(20-2)10-6-13/h3-7,9-10H,1,8,11-12H2,2H3/b7-4+ |
| InChIKey | CGJNSCLEVFRBJB-QPJJXVBHSA-N |
| XLogP | 2.87 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one?
The IUPAC name of 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one (CID 1475385) is 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one?
The canonical SMILES for 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one is C=CCN1N=C(/C=C/c2ccc(OC)cc2)CCC1=O.
What is the InChIKey of 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one?
The InChIKey is CGJNSCLEVFRBJB-QPJJXVBHSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-3-12-18-16(19)11-8-14(17-18)7-4-13-5-9-15(20-2)10-6-13/h3-7,9-10H,1,8,11-12H2,2H3/b7-4+.
What are the key properties of 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one?
6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one has a molecular weight of 270.33 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-prop-2-enyl-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 1475385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).