About 1,3-dimethylpurine-2,6,8-trione
1,3-dimethylpurine-2,6,8-trione (PubChem CID 14754220) has the molecular formula C7H6N4O3
and a molecular weight of 194.15 g/mol. Its IUPAC name is 1,3-dimethylpurine-2,6,8-trione.
Molecular Properties
| Compound Name | 1,3-dimethylpurine-2,6,8-trione |
| PubChem CID | 14754220 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1,3-dimethylpurine-2,6,8-trione |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC(=O)N=2 |
| InChI | InChI=1S/C7H6N4O3/c1-10-4-3(8-6(13)9-4)5(12)11(2)7(10)14/h1-2H3 |
| InChIKey | XNSYLGPLANWBHH-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 85.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dimethylpurine-2,6,8-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpurine-2,6,8-trione?
The IUPAC name of 1,3-dimethylpurine-2,6,8-trione (CID 14754220) is 1,3-dimethylpurine-2,6,8-trione.
What is the SMILES notation for 1,3-dimethylpurine-2,6,8-trione?
The canonical SMILES for 1,3-dimethylpurine-2,6,8-trione is Cn1c(=O)c2c(n(C)c1=O)=NC(=O)N=2.
What is the InChIKey of 1,3-dimethylpurine-2,6,8-trione?
The InChIKey is XNSYLGPLANWBHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O3/c1-10-4-3(8-6(13)9-4)5(12)11(2)7(10)14/h1-2H3.
What are the key properties of 1,3-dimethylpurine-2,6,8-trione?
1,3-dimethylpurine-2,6,8-trione has a molecular weight of 194.15 g/mol, XLogP of -2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpurine-2,6,8-trione is sourced from PubChem (CID 14754220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).