C33H34N6O2 — CID 147544424
3-[6-[[4-[[4-(2-hydroxyethyl)cyclohexa-2,4-dien-1-yl]diazenyl]naphthalen-1-yl]diazenyl]-2-methyl-1,3-dihydroperimidin-2-yl]propan-1-ol (PubChem CID 147544424) has the molecular formula C33H34N6O2 and a molecular weight of 546.68 g/mol. Its IUPAC name is 3-[6-[[4-[[4-(2-hydroxyethyl)cyclohexa-2,4-dien-1-yl]diazenyl]naphthalen-1-yl]diazenyl]-2-methyl-1,3-dihydroperimidin-2-yl]propan-1-ol.
| Compound Name | 3-[6-[[4-[[4-(2-hydroxyethyl)cyclohexa-2,4-dien-1-yl]diazenyl]naphthalen-1-yl]diazenyl]-2-methyl-1,3-dihydroperimidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 147544424 |
| Molecular Formula | C33H34N6O2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 3-[6-[[4-[[4-(2-hydroxyethyl)cyclohexa-2,4-dien-1-yl]diazenyl]naphthalen-1-yl]diazenyl]-2-methyl-1,3-dihydroperimidin-2-yl]propan-1-ol |
| SMILES | CC1(CCCO)Nc2cccc3c(/N=N/c4ccc(/N=N/C5C=CC(CCO)=CC5)c5ccccc45)ccc(c23)N1 |
| InChI | InChI=1S/C33H34N6O2/c1-33(19-5-20-40)34-30-9-4-8-26-29(16-17-31(35-33)32(26)30)39-38-28-15-14-27(24-6-2-3-7-25(24)28)37-36-23-12-10-22(11-13-23)18-21-41/h2-4,6-12,14-17,23,34-35,40-41H,5,13,18-21H2,1H3/b37-36+,39-38+ |
| InChIKey | FPNXNBLMKHIUEY-DVQJGIKISA-N |
| XLogP | 8.46 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|