C27H25Cl2FN4O4 — CID 147546417
1-[(1S,5R)-6-[4-(3,4-dichloro-2-fluoroanilino)-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one (PubChem CID 147546417) has the molecular formula C27H25Cl2FN4O4 and a molecular weight of 559.43 g/mol. Its IUPAC name is 1-[(1S,5R)-6-[4-(3,4-dichloro-2-fluoroanilino)-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one.
| Compound Name | 1-[(1S,5R)-6-[4-(3,4-dichloro-2-fluoroanilino)-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 147546417 |
| Molecular Formula | C27H25Cl2FN4O4 |
| Molecular Weight | 559.43 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 1-[(1S,5R)-6-[4-(3,4-dichloro-2-fluoroanilino)-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H]2C[C@@H](C1)C2Oc1cc2c(Nc3ccc(Cl)c(Cl)c3F)ncnc2cc1O[C@@H]1CCOC1 |
| InChI | InChI=1S/C27H25Cl2FN4O4/c1-2-23(35)34-10-14-7-15(11-34)26(14)38-21-8-17-20(9-22(21)37-16-5-6-36-12-16)31-13-32-27(17)33-19-4-3-18(28)24(29)25(19)30/h2-4,8-9,13-16,26H,1,5-7,10-12H2,(H,31,32,33)/t14-,15+,16-,26?/m1/s1 |
| InChIKey | FPXMCKUYEVKSAT-XXEDGJEJSA-N |
| XLogP | 5.40 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|