About 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide
2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide (PubChem CID 147546607) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide |
| PubChem CID | 147546607 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide |
| SMILES | CSNC(=O)c1cnc(CC(C)(C)C)o1 |
| InChI | InChI=1S/C10H16N2O2S/c1-10(2,3)5-8-11-6-7(14-8)9(13)12-15-4/h6H,5H2,1-4H3,(H,12,13) |
| InChIKey | FPYKISBPMUVKLX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide?
The IUPAC name of 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide (CID 147546607) is 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide.
What is the SMILES notation for 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide?
The canonical SMILES for 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide is CSNC(=O)c1cnc(CC(C)(C)C)o1.
What is the InChIKey of 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide?
The InChIKey is FPYKISBPMUVKLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-10(2,3)5-8-11-6-7(14-8)9(13)12-15-4/h6H,5H2,1-4H3,(H,12,13).
What are the key properties of 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide?
2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide has a molecular weight of 228.32 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropyl)-N-methylsulfanyl-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 147546607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).