About 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine
7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine (PubChem CID 1475476) has the molecular formula C15H14ClN3
and a molecular weight of 271.75 g/mol. Its IUPAC name is 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine |
| PubChem CID | 1475476 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ncnc(Cl)c12 |
| InChI | InChI=1S/C15H14ClN3/c1-10-11(2)19(8-12-6-4-3-5-7-12)15-13(10)14(16)17-9-18-15/h3-7,9H,8H2,1-2H3 |
| InChIKey | OWTBZRBZLBQVFN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine?
The IUPAC name of 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine (CID 1475476) is 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine is Cc1c(C)n(Cc2ccccc2)c2ncnc(Cl)c12.
What is the InChIKey of 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine?
The InChIKey is OWTBZRBZLBQVFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN3/c1-10-11(2)19(8-12-6-4-3-5-7-12)15-13(10)14(16)17-9-18-15/h3-7,9H,8H2,1-2H3.
What are the key properties of 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine?
7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine has a molecular weight of 271.75 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 1475476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).