About 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol
5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol (PubChem CID 147548422) has the molecular formula C8H17F3OSi
and a molecular weight of 214.30 g/mol. Its IUPAC name is 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol.
Molecular Properties
| Compound Name | 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol |
| PubChem CID | 147548422 |
| Molecular Formula | C8H17F3OSi |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol |
| SMILES | C[SiH](C)CCCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C8H17F3OSi/c1-7(12,8(9,10)11)5-4-6-13(2)3/h12-13H,4-6H2,1-3H3 |
| InChIKey | FQHFLWSBRMMOBD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol?
The IUPAC name of 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol (CID 147548422) is 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol.
What is the SMILES notation for 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol?
The canonical SMILES for 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol is C[SiH](C)CCCC(C)(O)C(F)(F)F.
What is the InChIKey of 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol?
The InChIKey is FQHFLWSBRMMOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F3OSi/c1-7(12,8(9,10)11)5-4-6-13(2)3/h12-13H,4-6H2,1-3H3.
What are the key properties of 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol?
5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol has a molecular weight of 214.30 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-dimethylsilyl-1,1,1-trifluoro-2-methylpentan-2-ol is sourced from PubChem (CID 147548422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).