C32H39N2O4S2+ — CID 147551167
[1-[[4-[(1-carboxy-3-methylsulfanylpropyl)carbamoyl]-3-(2-methylphenyl)phenyl]methyl]-5-(phenoxymethyl)pyrrolidin-3-yl]-methylsulfanium (PubChem CID 147551167) has the molecular formula C32H39N2O4S2+ and a molecular weight of 579.81 g/mol. Its IUPAC name is [1-[[4-[(1-carboxy-3-methylsulfanylpropyl)carbamoyl]-3-(2-methylphenyl)phenyl]methyl]-5-(phenoxymethyl)pyrrolidin-3-yl]-methylsulfanium.
| Compound Name | [1-[[4-[(1-carboxy-3-methylsulfanylpropyl)carbamoyl]-3-(2-methylphenyl)phenyl]methyl]-5-(phenoxymethyl)pyrrolidin-3-yl]-methylsulfanium |
|---|---|
| PubChem CID | 147551167 |
| Molecular Formula | C32H39N2O4S2+ |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | [1-[[4-[(1-carboxy-3-methylsulfanylpropyl)carbamoyl]-3-(2-methylphenyl)phenyl]methyl]-5-(phenoxymethyl)pyrrolidin-3-yl]-methylsulfanium |
| SMILES | CSCCC(NC(=O)c1ccc(CN2CC([SH+]C)CC2COc2ccccc2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C32H38N2O4S2/c1-22-9-7-8-12-27(22)29-17-23(13-14-28(29)31(35)33-30(32(36)37)15-16-39-2)19-34-20-26(40-3)18-24(34)21-38-25-10-5-4-6-11-25/h4-14,17,24,26,30H,15-16,18-21H2,1-3H3,(H,33,35)(H,36,37)/p+1 |
| InChIKey | FQULCQKJGXKQPM-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|