About 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine
4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine (PubChem CID 1475540) has the molecular formula C17H19Cl2N3OS2
and a molecular weight of 416.40 g/mol. Its IUPAC name is 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine.
Molecular Properties
| Compound Name | 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine |
| PubChem CID | 1475540 |
| Molecular Formula | C17H19Cl2N3OS2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine |
| SMILES | CSCc1cc(N2CCOCC2)nc(SCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C17H19Cl2N3OS2/c1-24-11-14-9-16(22-4-6-23-7-5-22)21-17(20-14)25-10-12-2-3-13(18)8-15(12)19/h2-3,8-9H,4-7,10-11H2,1H3 |
| InChIKey | JMXKOJOEWDSXCE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine?
The IUPAC name of 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine (CID 1475540) is 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine.
What is the SMILES notation for 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine?
The canonical SMILES for 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine is CSCc1cc(N2CCOCC2)nc(SCc2ccc(Cl)cc2Cl)n1.
What is the InChIKey of 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine?
The InChIKey is JMXKOJOEWDSXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Cl2N3OS2/c1-24-11-14-9-16(22-4-6-23-7-5-22)21-17(20-14)25-10-12-2-3-13(18)8-15(12)19/h2-3,8-9H,4-7,10-11H2,1H3.
What are the key properties of 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine?
4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine has a molecular weight of 416.40 g/mol, XLogP of 4.78, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(2,4-dichlorophenyl)methylsulfanyl]-6-(methylsulfanylmethyl)pyrimidin-4-yl]morpholine is sourced from PubChem (CID 1475540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).