C13H18O2 — CID 14755522
(E)-4-hydroxy-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-en-1-one (PubChem CID 14755522) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (E)-4-hydroxy-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-en-1-one.
| Compound Name | (E)-4-hydroxy-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 14755522 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (E)-4-hydroxy-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-en-1-one |
| SMILES | CC1=C(C(=O)/C=C/CO)C(C)(C)CC=C1 |
| InChI | InChI=1S/C13H18O2/c1-10-6-4-8-13(2,3)12(10)11(15)7-5-9-14/h4-7,14H,8-9H2,1-3H3/b7-5+ |
| InChIKey | AMUXTOTYHPDPPJ-FNORWQNLSA-N |
| XLogP | 2.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|