C59H45NO6 — CID 147555954
diethyl 2-[4-(N-[4-(2,5-diformyl-4-naphthalen-2-ylphenyl)phenyl]-4-methylanilino)phenyl]-5-naphthalen-2-ylbenzene-1,4-dicarboxylate (PubChem CID 147555954) has the molecular formula C59H45NO6 and a molecular weight of 864.01 g/mol. Its IUPAC name is diethyl 2-[4-(N-[4-(2,5-diformyl-4-naphthalen-2-ylphenyl)phenyl]-4-methylanilino)phenyl]-5-naphthalen-2-ylbenzene-1,4-dicarboxylate.
| Compound Name | diethyl 2-[4-(N-[4-(2,5-diformyl-4-naphthalen-2-ylphenyl)phenyl]-4-methylanilino)phenyl]-5-naphthalen-2-ylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 147555954 |
| Molecular Formula | C59H45NO6 |
| Molecular Weight | 864.01 g/mol |
| Exact Mass | 863.32 |
| IUPAC Name | diethyl 2-[4-(N-[4-(2,5-diformyl-4-naphthalen-2-ylphenyl)phenyl]-4-methylanilino)phenyl]-5-naphthalen-2-ylbenzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc3ccccc3c2)c(C(=O)OCC)cc1-c1ccc(N(c2ccc(C)cc2)c2ccc(-c3cc(C=O)c(-c4ccc5ccccc5c4)cc3C=O)cc2)cc1 |
| InChI | InChI=1S/C59H45NO6/c1-4-65-58(63)56-35-55(46-19-17-40-11-7-9-13-44(40)31-46)57(59(64)66-5-2)34-54(56)42-22-28-51(29-23-42)60(49-24-14-38(3)15-25-49)50-26-20-41(21-27-50)52-32-48(37-62)53(33-47(52)36-61)45-18-16-39-10-6-8-12-43(39)30-45/h6-37H,4-5H2,1-3H3 |
| InChIKey | FRRGLFPOEMIXOL-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.01 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|