C10H20F2N2O — CID 147558293
(2S)-4-(difluoromethoxymethyl)-N-methyl-2-propan-2-ylpyrrolidin-1-amine (PubChem CID 147558293) has the molecular formula C10H20F2N2O and a molecular weight of 222.28 g/mol. Its IUPAC name is (2S)-4-(difluoromethoxymethyl)-N-methyl-2-propan-2-ylpyrrolidin-1-amine.
| Compound Name | (2S)-4-(difluoromethoxymethyl)-N-methyl-2-propan-2-ylpyrrolidin-1-amine |
|---|---|
| PubChem CID | 147558293 |
| Molecular Formula | C10H20F2N2O |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (2S)-4-(difluoromethoxymethyl)-N-methyl-2-propan-2-ylpyrrolidin-1-amine |
| SMILES | CNN1CC(COC(F)F)C[C@H]1C(C)C |
| InChI | InChI=1S/C10H20F2N2O/c1-7(2)9-4-8(5-14(9)13-3)6-15-10(11)12/h7-10,13H,4-6H2,1-3H3/t8?,9-/m0/s1 |
| InChIKey | FSCPSEUQYLDUBT-GKAPJAKFSA-N |
| XLogP | 1.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |