C15H31NO5 — CID 147559887
6-(non-1-en-2-ylamino)hexane-1,2,3,4,5-pentol (PubChem CID 147559887) has the molecular formula C15H31NO5 and a molecular weight of 305.42 g/mol. Its IUPAC name is 6-(non-1-en-2-ylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 6-(non-1-en-2-ylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 147559887 |
| Molecular Formula | C15H31NO5 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 6-(non-1-en-2-ylamino)hexane-1,2,3,4,5-pentol |
| SMILES | C=C(CCCCCCC)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C15H31NO5/c1-3-4-5-6-7-8-11(2)16-9-12(18)14(20)15(21)13(19)10-17/h12-21H,2-10H2,1H3 |
| InChIKey | FSKPTSFMCGEKDM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|