About 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one
6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one (PubChem CID 147562569) has the molecular formula C6H7AlF3N3O
and a molecular weight of 221.12 g/mol. Its IUPAC name is 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one |
| PubChem CID | 147562569 |
| Molecular Formula | C6H7AlF3N3O |
| Molecular Weight | 221.12 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one |
| SMILES | CCn1c(C(F)(F)F)nnc([AlH2])c1=O |
| InChI | InChI=1S/C6H5F3N3O.Al.2H/c1-2-12-4(13)3-10-11-5(12)6(7,8)9;;;/h2H2,1H3;;; |
| InChIKey | FSXYJSZPYZXIFZ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.12 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one?
The IUPAC name of 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one (CID 147562569) is 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one.
What is the SMILES notation for 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one?
The canonical SMILES for 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one is CCn1c(C(F)(F)F)nnc([AlH2])c1=O.
What is the InChIKey of 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one?
The InChIKey is FSXYJSZPYZXIFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N3O.Al.2H/c1-2-12-4(13)3-10-11-5(12)6(7,8)9;;;/h2H2,1H3;;;.
What are the key properties of 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one?
6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one has a molecular weight of 221.12 g/mol, XLogP of -1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-alumanyl-4-ethyl-3-(trifluoromethyl)-1,2,4-triazin-5-one is sourced from PubChem (CID 147562569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).