C28H44N2O11 — CID 147562836
(2R,5S)-5-[3-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-2,6-dimethyl-4-oxoheptanoic acid (PubChem CID 147562836) has the molecular formula C28H44N2O11 and a molecular weight of 584.66 g/mol. Its IUPAC name is (2R,5S)-5-[3-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-2,6-dimethyl-4-oxoheptanoic acid.
| Compound Name | (2R,5S)-5-[3-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-2,6-dimethyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 147562836 |
| Molecular Formula | C28H44N2O11 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | (2R,5S)-5-[3-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-2,6-dimethyl-4-oxoheptanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCOCCOCCOCCOCCCC(=O)CCN1C(=O)C=CC1=O)C(=O)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C28H44N2O11/c1-20(2)27(23(32)19-21(3)28(36)37)29-24(33)9-12-39-14-16-41-18-17-40-15-13-38-11-4-5-22(31)8-10-30-25(34)6-7-26(30)35/h6-7,20-21,27H,4-5,8-19H2,1-3H3,(H,29,33)(H,36,37)/t21-,27+/m1/s1 |
| InChIKey | FSZCNGIEIVFVTJ-ZBLYBZFDSA-N |
| XLogP | 0.93 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|