C28H24 — CID 147563124
1,4-bis[(Z)-2-(4-methylphenyl)ethenyl]naphthalene (PubChem CID 147563124) has the molecular formula C28H24 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1,4-bis[(Z)-2-(4-methylphenyl)ethenyl]naphthalene.
| Compound Name | 1,4-bis[(Z)-2-(4-methylphenyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 147563124 |
| Molecular Formula | C28H24 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1,4-bis[(Z)-2-(4-methylphenyl)ethenyl]naphthalene |
| SMILES | Cc1ccc(/C=C\c2ccc(/C=C\c3ccc(C)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H24/c1-21-7-11-23(12-8-21)15-17-25-19-20-26(28-6-4-3-5-27(25)28)18-16-24-13-9-22(2)10-14-24/h3-20H,1-2H3/b17-15-,18-16- |
| InChIKey | FTAKQGBXUQRQFK-IQRFGFHNSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|