About 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine
2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine (PubChem CID 1475674) has the molecular formula C15H17NO4S
and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine.
Molecular Properties
| Compound Name | 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine |
| PubChem CID | 1475674 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine |
| SMILES | COc1ccc(Oc2nc(C)cc(C)c2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H17NO4S/c1-10-9-11(2)16-15(14(10)21(4,17)18)20-13-7-5-12(19-3)6-8-13/h5-9H,1-4H3 |
| InChIKey | CWSWRRUTAJLONR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine?
The IUPAC name of 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine (CID 1475674) is 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine.
What is the SMILES notation for 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine?
The canonical SMILES for 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine is COc1ccc(Oc2nc(C)cc(C)c2S(C)(=O)=O)cc1.
What is the InChIKey of 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine?
The InChIKey is CWSWRRUTAJLONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO4S/c1-10-9-11(2)16-15(14(10)21(4,17)18)20-13-7-5-12(19-3)6-8-13/h5-9H,1-4H3.
What are the key properties of 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine?
2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine has a molecular weight of 307.37 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenoxy)-4,6-dimethyl-3-methylsulfonylpyridine is sourced from PubChem (CID 1475674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).