About N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide
N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide (PubChem CID 1475689) has the molecular formula C16H17F2N3O3S
and a molecular weight of 369.39 g/mol. Its IUPAC name is N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide.
Molecular Properties
| Compound Name | N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide |
| PubChem CID | 1475689 |
| Molecular Formula | C16H17F2N3O3S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide |
| SMILES | Cc1cc(C)c(S(C)(=O)=O)c(N(C)NC(=O)c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C16H17F2N3O3S/c1-9-8-10(2)19-15(14(9)25(4,23)24)21(3)20-16(22)13-11(17)6-5-7-12(13)18/h5-8H,1-4H3,(H,20,22) |
| InChIKey | ACWHJLLNWWRENW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide?
The IUPAC name of N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide (CID 1475689) is N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide.
What is the SMILES notation for N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide?
The canonical SMILES for N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide is Cc1cc(C)c(S(C)(=O)=O)c(N(C)NC(=O)c2c(F)cccc2F)n1.
What is the InChIKey of N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide?
The InChIKey is ACWHJLLNWWRENW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O3S/c1-9-8-10(2)19-15(14(9)25(4,23)24)21(3)20-16(22)13-11(17)6-5-7-12(13)18/h5-8H,1-4H3,(H,20,22).
What are the key properties of N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide?
N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide has a molecular weight of 369.39 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,6-dimethyl-3-methylsulfonyl-2-pyridinyl)-2,6-difluoro-N'-methylbenzohydrazide is sourced from PubChem (CID 1475689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).