C14H29N5O — CID 147569924
1-[(3R)-1-(5-amino-5-iminopentyl)pyrrolidin-3-yl]-3-tert-butylurea (PubChem CID 147569924) has the molecular formula C14H29N5O and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-[(3R)-1-(5-amino-5-iminopentyl)pyrrolidin-3-yl]-3-tert-butylurea.
| Compound Name | 1-[(3R)-1-(5-amino-5-iminopentyl)pyrrolidin-3-yl]-3-tert-butylurea |
|---|---|
| PubChem CID | 147569924 |
| Molecular Formula | C14H29N5O |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | 1-[(3R)-1-(5-amino-5-iminopentyl)pyrrolidin-3-yl]-3-tert-butylurea |
| SMILES | [H]/N=C(\N)CCCCN1CC[C@@H](NC(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C14H29N5O/c1-14(2,3)18-13(20)17-11-7-9-19(10-11)8-5-4-6-12(15)16/h11H,4-10H2,1-3H3,(H3,15,16)(H2,17,18,20)/t11-/m1/s1 |
| InChIKey | FUHQHIOXKOKIJP-LLVKDONJSA-N |
| XLogP | 1.26 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|