About (E)-2-aminooctadec-8-ene-1,3,4-triol
(E)-2-aminooctadec-8-ene-1,3,4-triol (PubChem CID 14757419) has the molecular formula C18H37NO3
and a molecular weight of 315.50 g/mol. Its IUPAC name is (E)-2-aminooctadec-8-ene-1,3,4-triol.
Molecular Properties
| Compound Name | (E)-2-aminooctadec-8-ene-1,3,4-triol |
| PubChem CID | 14757419 |
| Molecular Formula | C18H37NO3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | (E)-2-aminooctadec-8-ene-1,3,4-triol |
| SMILES | CCCCCCCCC/C=C/CCCC(O)C(O)C(N)CO |
| InChI | InChI=1S/C18H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h10-11,16-18,20-22H,2-9,12-15,19H2,1H3/b11-10+ |
| InChIKey | CQKNELOTFUSOTP-ZHACJKMWSA-N |
| XLogP | 2.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-aminooctadec-8-ene-1,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-aminooctadec-8-ene-1,3,4-triol?
The IUPAC name of (E)-2-aminooctadec-8-ene-1,3,4-triol (CID 14757419) is (E)-2-aminooctadec-8-ene-1,3,4-triol.
What is the SMILES notation for (E)-2-aminooctadec-8-ene-1,3,4-triol?
The canonical SMILES for (E)-2-aminooctadec-8-ene-1,3,4-triol is CCCCCCCCC/C=C/CCCC(O)C(O)C(N)CO.
What is the InChIKey of (E)-2-aminooctadec-8-ene-1,3,4-triol?
The InChIKey is CQKNELOTFUSOTP-ZHACJKMWSA-N. The full InChI is InChI=1S/C18H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h10-11,16-18,20-22H,2-9,12-15,19H2,1H3/b11-10+.
What are the key properties of (E)-2-aminooctadec-8-ene-1,3,4-triol?
(E)-2-aminooctadec-8-ene-1,3,4-triol has a molecular weight of 315.50 g/mol, XLogP of 2.89, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-aminooctadec-8-ene-1,3,4-triol is sourced from PubChem (CID 14757419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).