About ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate
ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate (PubChem CID 1475746) has the molecular formula C13H15N5O2
and a molecular weight of 273.30 g/mol. Its IUPAC name is ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate.
Molecular Properties
| Compound Name | ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate |
| PubChem CID | 1475746 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate |
| SMILES | CCOC(Cn1cncn1)=NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H15N5O2/c1-2-20-12(8-18-10-14-9-15-18)17-13(19)16-11-6-4-3-5-7-11/h3-7,9-10H,2,8H2,1H3,(H,16,19) |
| InChIKey | BMHXMUXNSFBMHL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate?
The IUPAC name of ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate (CID 1475746) is ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate.
What is the SMILES notation for ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate?
The canonical SMILES for ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate is CCOC(Cn1cncn1)=NC(=O)Nc1ccccc1.
What is the InChIKey of ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate?
The InChIKey is BMHXMUXNSFBMHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O2/c1-2-20-12(8-18-10-14-9-15-18)17-13(19)16-11-6-4-3-5-7-11/h3-7,9-10H,2,8H2,1H3,(H,16,19).
What are the key properties of ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate?
ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate has a molecular weight of 273.30 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(phenylcarbamoyl)-2-(1,2,4-triazol-1-yl)ethanimidate is sourced from PubChem (CID 1475746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).