C16H27N3O3 — CID 147575393
11-(2,5-dioxopyrrol-1-yl)-N'-methylundecanehydrazide (PubChem CID 147575393) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 11-(2,5-dioxopyrrol-1-yl)-N'-methylundecanehydrazide.
| Compound Name | 11-(2,5-dioxopyrrol-1-yl)-N'-methylundecanehydrazide |
|---|---|
| PubChem CID | 147575393 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 11-(2,5-dioxopyrrol-1-yl)-N'-methylundecanehydrazide |
| SMILES | CNNC(=O)CCCCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H27N3O3/c1-17-18-14(20)10-8-6-4-2-3-5-7-9-13-19-15(21)11-12-16(19)22/h11-12,17H,2-10,13H2,1H3,(H,18,20) |
| InChIKey | FVJIDUSCAOXQNT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|