C42H37BNO2S — CID 147577669
CID 147577669 (PubChem CID 147577669) has the molecular formula C42H37BNO2S and a molecular weight of 630.64 g/mol.
| Compound Name | CID 147577669 |
|---|---|
| PubChem CID | 147577669 |
| Molecular Formula | C42H37BNO2S |
| Molecular Weight | 630.64 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cc(C2=C3Sc4ccccc4C3CC=C2)cc(-c2ccc3c(c2)c2ccccc2n3-c2ccccc2)c1 |
| InChI | InChI=1S/C42H37BNO2S/c1-41(2,45)42(3,4)46-43-30-24-28(23-29(25-30)32-17-12-18-35-34-16-9-11-20-39(34)47-40(32)35)27-21-22-38-36(26-27)33-15-8-10-19-37(33)44(38)31-13-6-5-7-14-31/h5-17,19-26,35,45H,18H2,1-4H3 |
| InChIKey | NHTUWRBLELZJAP-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.64 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|