About 1-cyclohexa-1,4,5-trien-1-ylethanone
1-cyclohexa-1,4,5-trien-1-ylethanone (PubChem CID 147577852) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is 1-cyclohexa-1,4,5-trien-1-ylethanone.
Molecular Properties
| Compound Name | 1-cyclohexa-1,4,5-trien-1-ylethanone |
| PubChem CID | 147577852 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 1-cyclohexa-1,4,5-trien-1-ylethanone |
| SMILES | CC(=O)C1=CCC=C=C1 |
| InChI | InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2,5-6H,3H2,1H3 |
| InChIKey | FVVGIHXTJDIMRA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,4,5-trien-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,4,5-trien-1-ylethanone?
The IUPAC name of 1-cyclohexa-1,4,5-trien-1-ylethanone (CID 147577852) is 1-cyclohexa-1,4,5-trien-1-ylethanone.
What is the SMILES notation for 1-cyclohexa-1,4,5-trien-1-ylethanone?
The canonical SMILES for 1-cyclohexa-1,4,5-trien-1-ylethanone is CC(=O)C1=CCC=C=C1.
What is the InChIKey of 1-cyclohexa-1,4,5-trien-1-ylethanone?
The InChIKey is FVVGIHXTJDIMRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2,5-6H,3H2,1H3.
What are the key properties of 1-cyclohexa-1,4,5-trien-1-ylethanone?
1-cyclohexa-1,4,5-trien-1-ylethanone has a molecular weight of 120.15 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,4,5-trien-1-ylethanone is sourced from PubChem (CID 147577852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).