C28H36O8 — CID 14757788
(4,5-diacetyloxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl) 3-phenyloxirane-2-carboxylate (PubChem CID 14757788) has the molecular formula C28H36O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is (4,5-diacetyloxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl) 3-phenyloxirane-2-carboxylate.
| Compound Name | (4,5-diacetyloxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl) 3-phenyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 14757788 |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | (4,5-diacetyloxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl) 3-phenyloxirane-2-carboxylate |
| SMILES | CC(=O)OC1CC(C)C23CC(CC(OC(=O)C4OC4c4ccccc4)C2(C)C1OC(C)=O)C(C)(C)O3 |
| InChI | InChI=1S/C28H36O8/c1-15-12-20(32-16(2)29)24(33-17(3)30)27(6)21(13-19-14-28(15,27)36-26(19,4)5)34-25(31)23-22(35-23)18-10-8-7-9-11-18/h7-11,15,19-24H,12-14H2,1-6H3 |
| InChIKey | LHKHAPJGLACMSP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 100.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|