C14H16N2O2PS+ — CID 147578576
5,10-dioxo-10-propan-2-yl-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium-1-amine (PubChem CID 147578576) has the molecular formula C14H16N2O2PS+ and a molecular weight of 307.34 g/mol. Its IUPAC name is 5,10-dioxo-10-propan-2-yl-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium-1-amine.
| Compound Name | 5,10-dioxo-10-propan-2-yl-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium-1-amine |
|---|---|
| PubChem CID | 147578576 |
| Molecular Formula | C14H16N2O2PS+ |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5,10-dioxo-10-propan-2-yl-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium-1-amine |
| SMILES | CC(C)P1(=O)c2ccccc2S(=O)c2ccc[n+](N)c21 |
| InChI | InChI=1S/C14H16N2O2PS/c1-10(2)19(17)11-6-3-4-7-12(11)20(18)13-8-5-9-16(15)14(13)19/h3-10H,15H2,1-2H3/q+1 |
| InChIKey | QIRUVLWLFNPHFJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|