C16H20O7 — CID 14757880
[(E,2S,3R)-3-acetyloxy-5-[(2S,3R)-3-[(2R)-6-oxo-2,3-dihydropyran-2-yl]oxiran-2-yl]pent-4-en-2-yl] acetate (PubChem CID 14757880) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is [(E,2S,3R)-3-acetyloxy-5-[(2S,3R)-3-[(2R)-6-oxo-2,3-dihydropyran-2-yl]oxiran-2-yl]pent-4-en-2-yl] acetate.
| Compound Name | [(E,2S,3R)-3-acetyloxy-5-[(2S,3R)-3-[(2R)-6-oxo-2,3-dihydropyran-2-yl]oxiran-2-yl]pent-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 14757880 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [(E,2S,3R)-3-acetyloxy-5-[(2S,3R)-3-[(2R)-6-oxo-2,3-dihydropyran-2-yl]oxiran-2-yl]pent-4-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@@H](/C=C/[C@@H]1O[C@@H]1[C@H]1CC=CC(=O)O1)OC(C)=O |
| InChI | InChI=1S/C16H20O7/c1-9(20-10(2)17)12(21-11(3)18)7-8-14-16(23-14)13-5-4-6-15(19)22-13/h4,6-9,12-14,16H,5H2,1-3H3/b8-7+/t9-,12+,13+,14-,16+/m0/s1 |
| InChIKey | RJCFRLFHBXKBFX-UXMHPJDPSA-N |
| XLogP | 1.07 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|