About [1-(3,4-dichlorophenyl)triazol-4-yl]methanol
[1-(3,4-dichlorophenyl)triazol-4-yl]methanol (PubChem CID 1475797) has the molecular formula C9H7Cl2N3O
and a molecular weight of 244.08 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(3,4-dichlorophenyl)triazol-4-yl]methanol |
| PubChem CID | 1475797 |
| Molecular Formula | C9H7Cl2N3O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | [1-(3,4-dichlorophenyl)triazol-4-yl]methanol |
| SMILES | OCc1cn(-c2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C9H7Cl2N3O/c10-8-2-1-7(3-9(8)11)14-4-6(5-15)12-13-14/h1-4,15H,5H2 |
| InChIKey | DMIRTDWEKUNBDX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(3,4-dichlorophenyl)triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dichlorophenyl)triazol-4-yl]methanol?
The IUPAC name of [1-(3,4-dichlorophenyl)triazol-4-yl]methanol (CID 1475797) is [1-(3,4-dichlorophenyl)triazol-4-yl]methanol.
What is the SMILES notation for [1-(3,4-dichlorophenyl)triazol-4-yl]methanol?
The canonical SMILES for [1-(3,4-dichlorophenyl)triazol-4-yl]methanol is OCc1cn(-c2ccc(Cl)c(Cl)c2)nn1.
What is the InChIKey of [1-(3,4-dichlorophenyl)triazol-4-yl]methanol?
The InChIKey is DMIRTDWEKUNBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2N3O/c10-8-2-1-7(3-9(8)11)14-4-6(5-15)12-13-14/h1-4,15H,5H2.
What are the key properties of [1-(3,4-dichlorophenyl)triazol-4-yl]methanol?
[1-(3,4-dichlorophenyl)triazol-4-yl]methanol has a molecular weight of 244.08 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dichlorophenyl)triazol-4-yl]methanol is sourced from PubChem (CID 1475797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).