C21H25F2N5O2 — CID 147582488
(2R)-2-amino-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(2,5-difluorophenyl)butanamide (PubChem CID 147582488) has the molecular formula C21H25F2N5O2 and a molecular weight of 417.46 g/mol. Its IUPAC name is (2R)-2-amino-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(2,5-difluorophenyl)butanamide.
| Compound Name | (2R)-2-amino-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(2,5-difluorophenyl)butanamide |
|---|---|
| PubChem CID | 147582488 |
| Molecular Formula | C21H25F2N5O2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | (2R)-2-amino-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(2,5-difluorophenyl)butanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@H](N)CCc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C21H25F2N5O2/c1-12(20(29)27-11-13-2-4-14(5-3-13)19(25)26)28-21(30)18(24)9-6-15-10-16(22)7-8-17(15)23/h2-5,7-8,10,12,18H,6,9,11,24H2,1H3,(H3,25,26)(H,27,29)(H,28,30)/t12-,18+/m0/s1 |
| InChIKey | FWRVFPVVTVQRRN-KPZWWZAWSA-N |
| XLogP | 1.33 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|