C35H46F4O5S — CID 147583036
3-methoxybutyl 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate (PubChem CID 147583036) has the molecular formula C35H46F4O5S and a molecular weight of 654.81 g/mol. Its IUPAC name is 3-methoxybutyl 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate.
| Compound Name | 3-methoxybutyl 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate |
|---|---|
| PubChem CID | 147583036 |
| Molecular Formula | C35H46F4O5S |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | 3-methoxybutyl 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate |
| SMILES | COC(C)CCOS(=O)(=O)c1c(F)c(F)c(Oc2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C35H46F4O5S/c1-22(42-2)18-19-43-45(40,41)35-31(38)29(36)34(30(37)32(35)39)44-33-27(24-14-8-4-9-15-24)20-26(23-12-6-3-7-13-23)21-28(33)25-16-10-5-11-17-25/h20-25H,3-19H2,1-2H3 |
| InChIKey | FWUPGIYXVWKGGA-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|