C17H23ClN9O7P — CID 147584907
[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-(2H-tetrazol-5-yl)methyl]phosphonic acid (PubChem CID 147584907) has the molecular formula C17H23ClN9O7P and a molecular weight of 531.85 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-(2H-tetrazol-5-yl)methyl]phosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-(2H-tetrazol-5-yl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 147584907 |
| Molecular Formula | C17H23ClN9O7P |
| Molecular Weight | 531.85 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-(2H-tetrazol-5-yl)methyl]phosphonic acid |
| SMILES | O=P(O)(O)C(OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)c1nn[nH]n1 |
| InChI | InChI=1S/C17H23ClN9O7P/c18-17-21-12(20-7-3-1-2-4-7)8-5-19-27(14(8)22-17)15-11(29)10(28)9(34-15)6-33-16(35(30,31)32)13-23-25-26-24-13/h5,7,9-11,15-16,28-29H,1-4,6H2,(H,20,21,22)(H2,30,31,32)(H,23,24,25,26)/t9-,10-,11-,15-,16?/m1/s1 |
| InChIKey | FXDOSQWZMWBRDY-CLBLVCIUSA-N |
| XLogP | -0.14 |
| TPSA | 226.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.85 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|