C16H28OSi — CID 14759138
(4a,8,8-trimethyl-5,6,7,8a-tetrahydronaphthalen-1-yl)oxy-trimethylsilane (PubChem CID 14759138) has the molecular formula C16H28OSi and a molecular weight of 264.49 g/mol. Its IUPAC name is (4a,8,8-trimethyl-5,6,7,8a-tetrahydronaphthalen-1-yl)oxy-trimethylsilane.
| Compound Name | (4a,8,8-trimethyl-5,6,7,8a-tetrahydronaphthalen-1-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 14759138 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.49 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (4a,8,8-trimethyl-5,6,7,8a-tetrahydronaphthalen-1-yl)oxy-trimethylsilane |
| SMILES | CC1(C)CCCC2(C)C=CC=C(O[Si](C)(C)C)C12 |
| InChI | InChI=1S/C16H28OSi/c1-15(2)10-8-12-16(3)11-7-9-13(14(15)16)17-18(4,5)6/h7,9,11,14H,8,10,12H2,1-6H3 |
| InChIKey | FYAZZAPDRBMCBT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|