About pyridin-3-ylmethyl 2H-chromene-3-carboxylate
pyridin-3-ylmethyl 2H-chromene-3-carboxylate (PubChem CID 1475919) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is pyridin-3-ylmethyl 2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl 2H-chromene-3-carboxylate |
| PubChem CID | 1475919 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | pyridin-3-ylmethyl 2H-chromene-3-carboxylate |
| SMILES | O=C(OCc1cccnc1)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C16H13NO3/c18-16(20-10-12-4-3-7-17-9-12)14-8-13-5-1-2-6-15(13)19-11-14/h1-9H,10-11H2 |
| InChIKey | MZSCCHBEFJBMJO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-3-ylmethyl 2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl 2H-chromene-3-carboxylate?
The IUPAC name of pyridin-3-ylmethyl 2H-chromene-3-carboxylate (CID 1475919) is pyridin-3-ylmethyl 2H-chromene-3-carboxylate.
What is the SMILES notation for pyridin-3-ylmethyl 2H-chromene-3-carboxylate?
The canonical SMILES for pyridin-3-ylmethyl 2H-chromene-3-carboxylate is O=C(OCc1cccnc1)C1=Cc2ccccc2OC1.
What is the InChIKey of pyridin-3-ylmethyl 2H-chromene-3-carboxylate?
The InChIKey is MZSCCHBEFJBMJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3/c18-16(20-10-12-4-3-7-17-9-12)14-8-13-5-1-2-6-15(13)19-11-14/h1-9H,10-11H2.
What are the key properties of pyridin-3-ylmethyl 2H-chromene-3-carboxylate?
pyridin-3-ylmethyl 2H-chromene-3-carboxylate has a molecular weight of 267.28 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl 2H-chromene-3-carboxylate is sourced from PubChem (CID 1475919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).