C12H20O3 — CID 14759592
7,8,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol (PubChem CID 14759592) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 7,8,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | 7,8,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 14759592 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 7,8,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
| SMILES | CC1=CC2(CC(C)(C)C1(C)O)OCCO2 |
| InChI | InChI=1S/C12H20O3/c1-9-7-12(14-5-6-15-12)8-10(2,3)11(9,4)13/h7,13H,5-6,8H2,1-4H3 |
| InChIKey | VJOGHSSAAAQMGP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|