C15H26O3 — CID 14759595
8-butyl-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol (PubChem CID 14759595) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 8-butyl-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | 8-butyl-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 14759595 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 8-butyl-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
| SMILES | CCCCC1(O)C(C)=CC2(CC1(C)C)OCCO2 |
| InChI | InChI=1S/C15H26O3/c1-5-6-7-15(16)12(2)10-14(11-13(15,3)4)17-8-9-18-14/h10,16H,5-9,11H2,1-4H3 |
| InChIKey | WQQDPPOPHSSONO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|