About N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine
N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 147598356) has the molecular formula C19H17F3N2S
and a molecular weight of 362.42 g/mol. Its IUPAC name is N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| PubChem CID | 147598356 |
| Molecular Formula | C19H17F3N2S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCN(c1nc(-c2ccccc2C(F)(F)F)cs1)c1ccccc1C |
| InChI | InChI=1S/C19H17F3N2S/c1-3-24(17-11-7-4-8-13(17)2)18-23-16(12-25-18)14-9-5-6-10-15(14)19(20,21)22/h4-12H,3H2,1-2H3 |
| InChIKey | FZQHYIRCSHPOGT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The IUPAC name of N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (CID 147598356) is N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
What is the SMILES notation for N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The canonical SMILES for N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine is CCN(c1nc(-c2ccccc2C(F)(F)F)cs1)c1ccccc1C.
What is the InChIKey of N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The InChIKey is FZQHYIRCSHPOGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3N2S/c1-3-24(17-11-7-4-8-13(17)2)18-23-16(12-25-18)14-9-5-6-10-15(14)19(20,21)22/h4-12H,3H2,1-2H3.
What are the key properties of N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine has a molecular weight of 362.42 g/mol, XLogP of 6.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(2-methylphenyl)-4-[2-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 147598356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).