About N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide
N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide (PubChem CID 147598886) has the molecular formula C10H19F2NO2S
and a molecular weight of 255.33 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide |
| PubChem CID | 147598886 |
| Molecular Formula | C10H19F2NO2S |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide |
| SMILES | CC[C@H]1CC[C@@H](N(CC(F)F)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H19F2NO2S/c1-3-8-4-5-9(6-8)13(7-10(11)12)16(2,14)15/h8-10H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | FZSVIXANTNSIHP-DTWKUNHWSA-N |
| XLogP | 2.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide?
The IUPAC name of N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide (CID 147598886) is N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide?
The canonical SMILES for N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide is CC[C@H]1CC[C@@H](N(CC(F)F)S(C)(=O)=O)C1.
What is the InChIKey of N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide?
The InChIKey is FZSVIXANTNSIHP-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H19F2NO2S/c1-3-8-4-5-9(6-8)13(7-10(11)12)16(2,14)15/h8-10H,3-7H2,1-2H3/t8-,9+/m0/s1.
What are the key properties of N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide?
N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide has a molecular weight of 255.33 g/mol, XLogP of 2.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-N-[(1R,3S)-3-ethylcyclopentyl]methanesulfonamide is sourced from PubChem (CID 147598886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).