About methyl 4-diazobutanoate
methyl 4-diazobutanoate (PubChem CID 14760193) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is methyl 4-diazobutanoate.
Molecular Properties
| Compound Name | methyl 4-diazobutanoate |
| PubChem CID | 14760193 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | methyl 4-diazobutanoate |
| SMILES | COC(=O)CCC=[N+]=[N-] |
| InChI | InChI=1S/C5H8N2O2/c1-9-5(8)3-2-4-7-6/h4H,2-3H2,1H3 |
| InChIKey | LHOBIDIXFQQSEU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-diazobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-diazobutanoate?
The IUPAC name of methyl 4-diazobutanoate (CID 14760193) is methyl 4-diazobutanoate.
What is the SMILES notation for methyl 4-diazobutanoate?
The canonical SMILES for methyl 4-diazobutanoate is COC(=O)CCC=[N+]=[N-].
What is the InChIKey of methyl 4-diazobutanoate?
The InChIKey is LHOBIDIXFQQSEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-9-5(8)3-2-4-7-6/h4H,2-3H2,1H3.
What are the key properties of methyl 4-diazobutanoate?
methyl 4-diazobutanoate has a molecular weight of 128.13 g/mol, XLogP of 0.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-diazobutanoate is sourced from PubChem (CID 14760193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).